Nuclear Magnetic Resonance Spectroscopy (NMR) Question?

How many signals would you see in the NMR spectrum of diisobutylamine? (Chemical Formula: CH3CH(CH3)CH2N(H)CH2CH(CH3)CH3.

Is it 4 because there are four equivalent hydrogen groups??
1 answer 1